Products 1197833-85-4
CAS 1197833-85-4 is the registry number for 1-(4-Bromo-2-fluorophenyl)-3-cyclopentylurea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-2-fluorophenyl)-3-cyclopentylurea (CAS 1197833-85-4) is a chemical compound with the molecular formula C12H14BrFN2O and a molecular weight of 301.15 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)-3-cyclopentylurea. InChIKey: FIWJFBVNEDGLMQ-UHFFFAOYSA-N.
| Molecular formula | C12H14BrFN2O |
|---|---|
| Molecular weight | 301.15 g/mol |
| IUPAC name | 1-(4-bromo-2-fluorophenyl)-3-cyclopentylurea |
| InChIKey | FIWJFBVNEDGLMQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC(=O)NC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)