CAS 1714857-13-2 is the registry number for 6-Bromo-4-tert-butyl-7-fluoro-1,2,3,4-tetrahydroquinoxalin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-4-tert-butyl-7-fluoro-1,3-dihydroquinoxalin-2-one (CAS 1714857-13-2) is a chemical compound with the molecular formula C12H14BrFN2O and a molecular weight of 301.15 g/mol. IUPAC name: 6-bromo-4-tert-butyl-7-fluoro-1,3-dihydroquinoxalin-2-one. InChIKey: DEROYPMMQZXKOY-UHFFFAOYSA-N.
| Molecular formula | C12H14BrFN2O |
|---|---|
| Molecular weight | 301.15 g/mol |
| IUPAC name | 6-bromo-4-tert-butyl-7-fluoro-1,3-dihydroquinoxalin-2-one |
| InChIKey | DEROYPMMQZXKOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1CC(=O)NC2=CC(=C(C=C21)Br)F |
Computed by PubChem (NCBI)