Products 1197904-57-6
CAS 1197904-57-6 is the registry number for S07-2001. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-acetyl-N-[[4-(sulfamoylmethyl)phenyl]methyl]-1H-pyrrole-2-carboxamide (CAS 1197904-57-6) is a chemical compound with the molecular formula C15H17N3O4S and a molecular weight of 335.4 g/mol. IUPAC name: 4-acetyl-N-[[4-(sulfamoylmethyl)phenyl]methyl]-1H-pyrrole-2-carboxamide. InChIKey: JWCFTUVQGAKKDZ-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O4S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-acetyl-N-[[4-(sulfamoylmethyl)phenyl]methyl]-1H-pyrrole-2-carboxamide |
| InChIKey | JWCFTUVQGAKKDZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CNC(=C1)C(=O)NCC2=CC=C(C=C2)CS(=O)(=O)N |
Computed by PubChem (NCBI)