CAS 326916-20-5 appears in our catalog under these names: 4-Ethoxy-n-[4-(hydrazinecarbonyl)phenyl]benzene-1-sulfonamide, 95%, 4-Ethoxy-N-(4-(hydrazinecarbonyl)phenyl)benzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-ethoxy-N-[4-(hydrazinecarbonyl)phenyl]benzenesulfonamide (CAS 326916-20-5) is a chemical compound with the molecular formula C15H17N3O4S and a molecular weight of 335.4 g/mol. IUPAC name: 4-ethoxy-N-[4-(hydrazinecarbonyl)phenyl]benzenesulfonamide. InChIKey: BOPIQZHITNGCMJ-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O4S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 4-ethoxy-N-[4-(hydrazinecarbonyl)phenyl]benzenesulfonamide |
| InChIKey | BOPIQZHITNGCMJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)NN |
Computed by PubChem (NCBI)