CAS 1197956-35-6 appears in our catalog under these names: (4-Amino-3-fluorophenyl)dimethylphosphine oxide, (4-Amino-3-fluorophenyl)dimethylphosphine oxide 95%, (4-Amino-3-fluorophenyl)dimethylphosphine oxide, 95%, 95%, (4-Amino-3-fluorophenyl)dimethylphosphine oxide, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g.
4-dimethylphosphoryl-2-fluoroaniline (CAS 1197956-35-6) is a chemical compound with the molecular formula C8H11FNOP and a molecular weight of 187.15 g/mol. IUPAC name: 4-dimethylphosphoryl-2-fluoroaniline. InChIKey: LRMFKTMOONLXRC-UHFFFAOYSA-N.
| Molecular formula | C8H11FNOP |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 4-dimethylphosphoryl-2-fluoroaniline |
| InChIKey | LRMFKTMOONLXRC-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC(=C(C=C1)N)F |
Computed by PubChem (NCBI)