Products 1198178-56-1

CAS 1198178-56-1 appears in our catalog under these names: 2,2-Dimethyl-3-piperazin-1-yl-propionic acid methyl ester dihydrochloride, 95%, Methyl 2,2-dimethyl-3-(piperazin-1-yl)propanoate dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2,2-dimethyl-3-piperazin-1-ylpropanoate;dihydrochloride (CAS 1198178-56-1) is a chemical compound with the molecular formula C10H22Cl2N2O2 and a molecular weight of 273.20 g/mol. IUPAC name: methyl 2,2-dimethyl-3-piperazin-1-ylpropanoate;dihydrochloride. InChIKey: JBGLUXPMWADOJT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22Cl2N2O2
Molecular weight273.20 g/mol
IUPAC namemethyl 2,2-dimethyl-3-piperazin-1-ylpropanoate;dihydrochloride
InChIKeyJBGLUXPMWADOJT-UHFFFAOYSA-N
SMILESCC(C)(CN1CCNCC1)C(=O)OC.Cl.Cl

Computed by PubChem (NCBI)