Products 896523-61-8

CAS 896523-61-8 is the registry number for 2-(4-Isobutylpiperazin-1-yl)acetic acid dihydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(2-methylpropyl)piperazin-1-yl]acetic acid;dihydrochloride (CAS 896523-61-8) is a chemical compound with the molecular formula C10H22Cl2N2O2 and a molecular weight of 273.20 g/mol. IUPAC name: 2-[4-(2-methylpropyl)piperazin-1-yl]acetic acid;dihydrochloride. InChIKey: MPOLKXIYJCHMST-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22Cl2N2O2
Molecular weight273.20 g/mol
IUPAC name2-[4-(2-methylpropyl)piperazin-1-yl]acetic acid;dihydrochloride
InChIKeyMPOLKXIYJCHMST-UHFFFAOYSA-N
SMILESCC(C)CN1CCN(CC1)CC(=O)O.Cl.Cl

Computed by PubChem (NCBI)