Products 1198283-79-2
CAS 1198283-79-2 is the registry number for tert-Butyl 4-(1hpyrrolo[2,3-b]pyridin-2-yl)piperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl 4-(1H-pyrrolo[2,3-b]pyridin-2-yl)piperidine-1-carboxylate (CAS 1198283-79-2) is a chemical compound with the molecular formula C17H23N3O2 and a molecular weight of 301.4 g/mol. IUPAC name: tert-butyl 4-(1H-pyrrolo[2,3-b]pyridin-2-yl)piperidine-1-carboxylate. InChIKey: BNVVBAUDFZIHGQ-UHFFFAOYSA-N.
| Molecular formula | C17H23N3O2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | tert-butyl 4-(1H-pyrrolo[2,3-b]pyridin-2-yl)piperidine-1-carboxylate |
| InChIKey | BNVVBAUDFZIHGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC3=C(N2)N=CC=C3 |
Computed by PubChem (NCBI)