CAS 2246354-69-6 appears in our catalog under these names: Vildagliptin Impurity 6, (S)-1-(2-(((1R,3R,5R,7S)-3-hydroxyadamantan-1-yl)imino)acetyl)pyrrolidine-2-carbonitrile, 98%, Vildagliptin Impurity 110. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-[2-[(3-hydroxy-1-adamantyl)imino]acetyl]pyrrolidine-2-carbonitrile (CAS 2246354-69-6) is a chemical compound with the molecular formula C17H23N3O2 and a molecular weight of 301.4 g/mol. IUPAC name: (2S)-1-[2-[(3-hydroxy-1-adamantyl)imino]acetyl]pyrrolidine-2-carbonitrile. InChIKey: MIBAUSIFADYGKR-XWTIBIIYSA-N.
| Molecular formula | C17H23N3O2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | (2S)-1-[2-[(3-hydroxy-1-adamantyl)imino]acetyl]pyrrolidine-2-carbonitrile |
| InChIKey | MIBAUSIFADYGKR-XWTIBIIYSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)C=NC23CC4CC(C2)CC(C4)(C3)O)C#N |
Computed by PubChem (NCBI)