Products 1198285-38-9
CAS 1198285-38-9 appears in our catalog under these names: 7-Nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 98%, tert-Butyl 4-(3-formylphenyl)piperidine-1-carboxylate, 98%, tert-Butyl 4-(3-formylphenyl)piperidine-1-carboxylate 97%, 7-Nitro-1,2,3,4-tetrahydroisoquinoline, HCl, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Tert-butyl 4-(3-formylphenyl)piperidine-1-carboxylate (CAS 1198285-38-9) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: tert-butyl 4-(3-formylphenyl)piperidine-1-carboxylate. InChIKey: QQYNNFALXKPDOU-UHFFFAOYSA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | tert-butyl 4-(3-formylphenyl)piperidine-1-carboxylate |
| InChIKey | QQYNNFALXKPDOU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)