CAS 1207062-33-6 is the registry number for tert-Butyl 3-(3-hydroxycinnamyl)azetidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 50mg.
Tert-butyl 3-[(E)-3-(3-hydroxyphenyl)prop-2-enyl]azetidine-1-carboxylate (CAS 1207062-33-6) is a chemical compound with the molecular formula C17H23NO3 and a molecular weight of 289.4 g/mol. IUPAC name: tert-butyl 3-[(E)-3-(3-hydroxyphenyl)prop-2-enyl]azetidine-1-carboxylate. InChIKey: WOZNRWGSSVOOFJ-GQCTYLIASA-N.
| Molecular formula | C17H23NO3 |
|---|---|
| Molecular weight | 289.4 g/mol |
| IUPAC name | tert-butyl 3-[(E)-3-(3-hydroxyphenyl)prop-2-enyl]azetidine-1-carboxylate |
| InChIKey | WOZNRWGSSVOOFJ-GQCTYLIASA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C/C=C/C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)