CAS 1198414-06-0 is the registry number for Pirfenidone Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-chlorophenyl)-5-methylpyridin-2-one (CAS 1198414-06-0) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 1-(2-chlorophenyl)-5-methylpyridin-2-one. InChIKey: YFHFQXYJYNXDRA-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-5-methylpyridin-2-one |
| InChIKey | YFHFQXYJYNXDRA-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=O)C=C1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)