CAS 1198416-32-8 appears in our catalog under these names: 2-Bromo-1-tosyl-1h-pyrrolo[2,3-b]pyridine, 95%, 2–Bromo–1–tosyl–1H–pyrrolo(2,3–b)pyridine, 2-Bromo-1-tosyl-1H-pyrrolo[2,3-b]pyridine. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 1198416-32-8) is a chemical compound with the molecular formula C14H11BrN2O2S and a molecular weight of 351.22 g/mol. IUPAC name: 2-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: MDLNSMRCPJEEFR-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O2S |
|---|---|
| Molecular weight | 351.22 g/mol |
| IUPAC name | 2-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | MDLNSMRCPJEEFR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=CC=C3)Br |
Computed by PubChem (NCBI)