CAS 479552-71-1 appears in our catalog under these names: 1H-Pyrrolo[2,3-b]pyridine, 5-bromo-1-[(4-methylphenyl)sulfonyl]-, 98%, 5-Bromo-1-tosyl-1H-pyrrolo(2,3-b)pyridine, 95+%, 5–Bromo–1–tosyl–1H–pyrrolo(2,3–b)pyridine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 25g, 250mg, 1g, 5g, 100mg.
5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 479552-71-1) is a chemical compound with the molecular formula C14H11BrN2O2S and a molecular weight of 351.22 g/mol. IUPAC name: 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: OJSPXCGTOYBBJX-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN2O2S |
|---|---|
| Molecular weight | 351.22 g/mol |
| IUPAC name | 5-bromo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | OJSPXCGTOYBBJX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC(=CN=C32)Br |
Computed by PubChem (NCBI)