CAS 1198437-24-9 appears in our catalog under these names: 4-Fluoro-1-isopropyl-1H-pyrazole-5-carboxylic acid, 97%, 4-Fluoro-1-isopropyl-1H-pyrazole-5-carboxylic acid, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
4-fluoro-1-propan-2-ylpyrazole-5-carboxylic acid (CAS 1198437-24-9) is a chemical compound with the molecular formula C7H9FN2O2 and a molecular weight of 172.16 g/mol. IUPAC name: 4-fluoro-1-propan-2-ylpyrazole-5-carboxylic acid. InChIKey: JQISSORYGWTWPH-UHFFFAOYSA-N.
| Molecular formula | C7H9FN2O2 |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | 4-fluoro-1-propan-2-ylpyrazole-5-carboxylic acid |
| InChIKey | JQISSORYGWTWPH-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=C(C=N1)F)C(=O)O |
Computed by PubChem (NCBI)