Products 1823402-99-8

CAS 1823402-99-8 is the registry number for 1-Ethyl-5-fluoro-3-methyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-ethyl-5-fluoro-3-methylpyrazole-4-carboxylic acid (CAS 1823402-99-8) is a chemical compound with the molecular formula C7H9FN2O2 and a molecular weight of 172.16 g/mol. IUPAC name: 1-ethyl-5-fluoro-3-methylpyrazole-4-carboxylic acid. InChIKey: YSHKCSUPBXMWAB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9FN2O2
Molecular weight172.16 g/mol
IUPAC name1-ethyl-5-fluoro-3-methylpyrazole-4-carboxylic acid
InChIKeyYSHKCSUPBXMWAB-UHFFFAOYSA-N
SMILESCCN1C(=C(C(=N1)C)C(=O)O)F

Computed by PubChem (NCBI)