Products 1198437-30-7

CAS 1198437-30-7 is the registry number for 1-Ethyl-4-fluoro-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-ethyl-4-fluoropyrazole-5-carboxylic acid (CAS 1198437-30-7) is a chemical compound with the molecular formula C6H7FN2O2 and a molecular weight of 158.13 g/mol. IUPAC name: 1-ethyl-4-fluoropyrazole-5-carboxylic acid. InChIKey: PTXAXLLWRHGJFC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7FN2O2
Molecular weight158.13 g/mol
IUPAC name1-ethyl-4-fluoropyrazole-5-carboxylic acid
InChIKeyPTXAXLLWRHGJFC-UHFFFAOYSA-N
SMILESCCN1C(=C(C=N1)F)C(=O)O

Computed by PubChem (NCBI)