Products 1401727-16-9

CAS 1401727-16-9 appears in our catalog under these names: 1-(2-Fluoroethyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(2-Fluoroethyl)-1H-pyrazole-4-carboxylic acid, 98%, 1-(2-Fluoroethyl)-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(2-fluoroethyl)pyrazole-4-carboxylic acid (CAS 1401727-16-9) is a chemical compound with the molecular formula C6H7FN2O2 and a molecular weight of 158.13 g/mol. IUPAC name: 1-(2-fluoroethyl)pyrazole-4-carboxylic acid. InChIKey: BDCXXWQWUCDYSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7FN2O2
Molecular weight158.13 g/mol
IUPAC name1-(2-fluoroethyl)pyrazole-4-carboxylic acid
InChIKeyBDCXXWQWUCDYSQ-UHFFFAOYSA-N
SMILESC1=C(C=NN1CCF)C(=O)O

Computed by PubChem (NCBI)