Products 1198617-51-4
CAS 1198617-51-4 is the registry number for 1-(3-Cyano-4-isobutoxyphenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-acetyl-2-(2-methylpropoxy)benzonitrile (CAS 1198617-51-4) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: 5-acetyl-2-(2-methylpropoxy)benzonitrile. InChIKey: VSNHMDQAWJYXIN-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | 5-acetyl-2-(2-methylpropoxy)benzonitrile |
| InChIKey | VSNHMDQAWJYXIN-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C(C=C1)C(=O)C)C#N |
Computed by PubChem (NCBI)