Products 199589-62-3
CAS 199589-62-3 appears in our catalog under these names: tert-Butyl 1h-indole-6-carboxylate, 95%, tert-Butyl 1H-indole-6-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 1H-indole-6-carboxylate (CAS 199589-62-3) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl 1H-indole-6-carboxylate. InChIKey: JPPXEBLKCSJFQO-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl 1H-indole-6-carboxylate |
| InChIKey | JPPXEBLKCSJFQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC2=C(C=C1)C=CN2 |
Computed by PubChem (NCBI)