Products 1200130-52-4
CAS 1200130-52-4 is the registry number for 3-Bromo-9H-pyrrolo[2,3-b:5,4-c']dipyridine-6-carbonitrile, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg.
12-bromo-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (CAS 1200130-52-4) is a chemical compound with the molecular formula C11H5BrN4 and a molecular weight of 273.09 g/mol. IUPAC name: 12-bromo-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile. InChIKey: XTOBMPDPWTVRSM-UHFFFAOYSA-N.
| Molecular formula | C11H5BrN4 |
|---|---|
| Molecular weight | 273.09 g/mol |
| IUPAC name | 12-bromo-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| InChIKey | XTOBMPDPWTVRSM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C3=C(N2)C=NC(=C3)C#N)Br |
Computed by PubChem (NCBI)