Products 1200508-80-0
CAS 1200508-80-0 is the registry number for rac-tert-Butyl (1R,2S,6S,7R)-8-oxo-4-azatricyclo(5.2.1.0,2,6)decane-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (1S,2R,6R,7S)-8-oxo-4-azatricyclo[5.2.1.02,6]decane-4-carboxylate (CAS 1200508-80-0) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl (1S,2R,6R,7S)-8-oxo-4-azatricyclo[5.2.1.02,6]decane-4-carboxylate. InChIKey: VOBLXDDCNPYQRE-MMWGEVLESA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl (1S,2R,6R,7S)-8-oxo-4-azatricyclo[5.2.1.02,6]decane-4-carboxylate |
| InChIKey | VOBLXDDCNPYQRE-MMWGEVLESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H]3C[C@@H]([C@@H]2C1)C(=O)C3 |
Computed by PubChem (NCBI)