CAS 1201013-61-7 appears in our catalog under these names: (3R)-1-(Propan-2-yl)pyrrolidin-3-amine dihydrochloride, 95%, (R)-1-Isopropylpyrrolidin-3-amine dihydrochloride, 98%, (R)-1-Isopropylpyrrolidin-3-amine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 2,5g.
(3R)-1-propan-2-ylpyrrolidin-3-amine;dihydrochloride (CAS 1201013-61-7) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (3R)-1-propan-2-ylpyrrolidin-3-amine;dihydrochloride. InChIKey: VBJDQXDPLUEPER-XCUBXKJBSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (3R)-1-propan-2-ylpyrrolidin-3-amine;dihydrochloride |
| InChIKey | VBJDQXDPLUEPER-XCUBXKJBSA-N |
| SMILES | CC(C)N1CC[C@H](C1)N.Cl.Cl |
Computed by PubChem (NCBI)