CAS 914498-27-4 appears in our catalog under these names: (3S)-1-(Propan-2-yl)pyrrolidin-3-amine dihydrochloride, 95%, (S)-1-Isopropylpyrrolidin-3-amine dihydrochloride, 97%, (3S)-1-(propan-2-yl)pyrrolidin-3-amine dihydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g, 25g.
(3S)-1-propan-2-ylpyrrolidin-3-amine;dihydrochloride (CAS 914498-27-4) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (3S)-1-propan-2-ylpyrrolidin-3-amine;dihydrochloride. InChIKey: VBJDQXDPLUEPER-KLXURFKVSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (3S)-1-propan-2-ylpyrrolidin-3-amine;dihydrochloride |
| InChIKey | VBJDQXDPLUEPER-KLXURFKVSA-N |
| SMILES | CC(C)N1CC[C@@H](C1)N.Cl.Cl |
Computed by PubChem (NCBI)