CAS 120107-66-6 is the registry number for 6-(2,4-Dichlorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
6-(2,4-dichlorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (CAS 120107-66-6) is a chemical compound with the molecular formula C12H6Cl2N2OS and a molecular weight of 297.2 g/mol. IUPAC name: 6-(2,4-dichlorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde. InChIKey: BFZJFUMQMZJNTC-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2OS |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 6-(2,4-dichlorophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| InChIKey | BFZJFUMQMZJNTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=C(N3C=CSC3=N2)C=O |
Computed by PubChem (NCBI)