CAS 339369-75-4 appears in our catalog under these names: 5-(2,4-Dichlorophenyl)thieno[2,3-d]pyrimidin-4(3h)-one, 95%, 5-(2,4-Dichlorophenyl)thieno(2,3-d)pyrimidin-4(3H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-(2,4-dichlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 339369-75-4) is a chemical compound with the molecular formula C12H6Cl2N2OS and a molecular weight of 297.2 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: YQIFSPQAKDSBPP-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2OS |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | YQIFSPQAKDSBPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CSC3=C2C(=O)NC=N3 |
Computed by PubChem (NCBI)