CAS 1201186-54-0 appears in our catalog under these names: Upadacitinib Impurity 2, 2-Bromo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine 98%, 2-Bromo-5-tosyl-5H-pyrrolo[2,3-b]pyrazine, 97%, 97%, N-Tosyl-5-bromo-4,7-diazaindole, 95%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g, 25g, 50mg.
2-bromo-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine (CAS 1201186-54-0) is a chemical compound with the molecular formula C13H10BrN3O2S and a molecular weight of 352.21 g/mol. IUPAC name: 2-bromo-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine. InChIKey: UMZKBENCNNDLRF-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O2S |
|---|---|
| Molecular weight | 352.21 g/mol |
| IUPAC name | 2-bromo-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine |
| InChIKey | UMZKBENCNNDLRF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=NC(=CN=C32)Br |
Computed by PubChem (NCBI)