CAS 1818847-41-4 appears in our catalog under these names: 7-Bromo-5-(4-methylbenzenesulfonyl)-5h-pyrrolo[2,3-b]pyrazine, 95%, 7-Bromo-5-tosyl-5H-pyrrolo(2,3-b)pyrazine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
7-bromo-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine (CAS 1818847-41-4) is a chemical compound with the molecular formula C13H10BrN3O2S and a molecular weight of 352.21 g/mol. IUPAC name: 7-bromo-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine. InChIKey: RZIHFWIVUHARMG-UHFFFAOYSA-N.
| Molecular formula | C13H10BrN3O2S |
|---|---|
| Molecular weight | 352.21 g/mol |
| IUPAC name | 7-bromo-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine |
| InChIKey | RZIHFWIVUHARMG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=NC=CN=C32)Br |
Computed by PubChem (NCBI)