Products 1201187-22-5
CAS 1201187-22-5 is the registry number for Rel-tert-butyl ((3R,4S)-4-(3,4-dichlorophenyl)pyrrolidin-3-yl)(methyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3R,4S)-4-(3,4-dichlorophenyl)pyrrolidin-3-yl]-N-methylcarbamate (CAS 1201187-22-5) is a chemical compound with the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.3 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-(3,4-dichlorophenyl)pyrrolidin-3-yl]-N-methylcarbamate. InChIKey: AKDDGBOFNAEWAT-RISCZKNCSA-N.
| Molecular formula | C16H22Cl2N2O2 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-(3,4-dichlorophenyl)pyrrolidin-3-yl]-N-methylcarbamate |
| InChIKey | AKDDGBOFNAEWAT-RISCZKNCSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H]1CNC[C@@H]1C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)