Products 1279219-15-6
CAS 1279219-15-6 is the registry number for 7,8-Dimethyl-4-(piperazin-1-ylmethyl)-2H-chromen-2-one dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,8-dimethyl-4-(piperazin-1-ylmethyl)chromen-2-one;dihydrochloride (CAS 1279219-15-6) is a chemical compound with the molecular formula C16H22Cl2N2O2 and a molecular weight of 345.3 g/mol. IUPAC name: 7,8-dimethyl-4-(piperazin-1-ylmethyl)chromen-2-one;dihydrochloride. InChIKey: XNHUDMBBGMYLPT-UHFFFAOYSA-N.
| Molecular formula | C16H22Cl2N2O2 |
|---|---|
| Molecular weight | 345.3 g/mol |
| IUPAC name | 7,8-dimethyl-4-(piperazin-1-ylmethyl)chromen-2-one;dihydrochloride |
| InChIKey | XNHUDMBBGMYLPT-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=CC(=O)O2)CN3CCNCC3)C.Cl.Cl |
Computed by PubChem (NCBI)