CAS 1201566-80-4 appears in our catalog under these names: 4,5-Dimethoxy-2-(methoxycarbonyl)phenylboronic acid pinacol ester, 96%, 4,5-Dimethoxy-2-(methoxycarbonyl)phenylboronic acid pinacol ester, Methyl 4,5-dimethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 96%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 0,5g, 100mg, 250mg.
Methyl 4,5-dimethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1201566-80-4) is a chemical compound with the molecular formula C16H23BO6 and a molecular weight of 322.2 g/mol. IUPAC name: methyl 4,5-dimethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: TUPWLISYCDGHEO-UHFFFAOYSA-N.
| Molecular formula | C16H23BO6 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | methyl 4,5-dimethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | TUPWLISYCDGHEO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C(=O)OC)OC)OC |
Computed by PubChem (NCBI)