CAS 1629604-13-2 is the registry number for (3,4-Dimethoxy-2-(methoxycarbonyl)phenyl)boronic acid pinacol ester, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 2,3-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1629604-13-2) is a chemical compound with the molecular formula C16H23BO6 and a molecular weight of 322.2 g/mol. IUPAC name: methyl 2,3-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: YPNGGLLENSMUOH-UHFFFAOYSA-N.
| Molecular formula | C16H23BO6 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | methyl 2,3-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | YPNGGLLENSMUOH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)OC)OC)C(=O)OC |
Computed by PubChem (NCBI)