Products 1201664-05-2

CAS 1201664-05-2 is the registry number for 3-Chloro-2-hydroxy-5-(trifluoromethyl)benzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-2-hydroxy-5-(trifluoromethyl)benzenesulfonyl chloride (CAS 1201664-05-2) is a chemical compound with the molecular formula C7H3Cl2F3O3S and a molecular weight of 295.06 g/mol. IUPAC name: 3-chloro-2-hydroxy-5-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: UWLBJXZDAKUSRY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2F3O3S
Molecular weight295.06 g/mol
IUPAC name3-chloro-2-hydroxy-5-(trifluoromethyl)benzenesulfonyl chloride
InChIKeyUWLBJXZDAKUSRY-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1S(=O)(=O)Cl)O)Cl)C(F)(F)F

Computed by PubChem (NCBI)