CAS 77797-64-9 appears in our catalog under these names: 5-Chloro-2-(trifluoromethoxy)benzenesulfonyl chloride, 95%, 5-Chloro-2-(trifluoromethoxy)benzene-1-sulfonyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
5-chloro-2-(trifluoromethoxy)benzenesulfonyl chloride (CAS 77797-64-9) is a chemical compound with the molecular formula C7H3Cl2F3O3S and a molecular weight of 295.06 g/mol. IUPAC name: 5-chloro-2-(trifluoromethoxy)benzenesulfonyl chloride. InChIKey: GEYCYNVQARGUJJ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F3O3S |
|---|---|
| Molecular weight | 295.06 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethoxy)benzenesulfonyl chloride |
| InChIKey | GEYCYNVQARGUJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)