CAS 1201693-88-0 is the registry number for 2-Chloro-7,7-difluoro-5-methyl-5,7,8,9-tetrahydro-6H-pyrimido[4,5-b][1,4]diazepin-6-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-7,7-difluoro-5-methyl-8,9-dihydropyrimido[4,5-b][1,4]diazepin-6-one (CAS 1201693-88-0) is a chemical compound with the molecular formula C8H7ClF2N4O and a molecular weight of 248.62 g/mol. IUPAC name: 2-chloro-7,7-difluoro-5-methyl-8,9-dihydropyrimido[4,5-b][1,4]diazepin-6-one. InChIKey: MUQPTFZFOLUFSD-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2N4O |
|---|---|
| Molecular weight | 248.62 g/mol |
| IUPAC name | 2-chloro-7,7-difluoro-5-methyl-8,9-dihydropyrimido[4,5-b][1,4]diazepin-6-one |
| InChIKey | MUQPTFZFOLUFSD-UHFFFAOYSA-N |
| SMILES | CN1C2=CN=C(N=C2NCC(C1=O)(F)F)Cl |
Computed by PubChem (NCBI)