CAS 2392952-25-7 is the registry number for 6-Chloro-3-(difluoro(methoxy)methyl)-7-methyl-[1,2,4]triazolo[4,3-b]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-3-[difluoro(methoxy)methyl]-7-methyl-[1,2,4]triazolo[4,3-b]pyridazine (CAS 2392952-25-7) is a chemical compound with the molecular formula C8H7ClF2N4O and a molecular weight of 248.62 g/mol. IUPAC name: 6-chloro-3-[difluoro(methoxy)methyl]-7-methyl-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: OBUXRGCDATXUHS-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF2N4O |
|---|---|
| Molecular weight | 248.62 g/mol |
| IUPAC name | 6-chloro-3-[difluoro(methoxy)methyl]-7-methyl-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | OBUXRGCDATXUHS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NN=C(N2N=C1Cl)C(OC)(F)F |
Computed by PubChem (NCBI)