CAS 120186-59-6 appears in our catalog under these names: 4-Benzyloxyphenylmagnesium bromide, 0.8M solution in THF, AcroSeal®, 4-BENZYLOXYPHENYLMAGNESIUM BROMIDE, 1M &. Offered by: Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ML.
Magnesium;phenylmethoxybenzene;bromide (CAS 120186-59-6) is a chemical compound with the molecular formula C13H11BrMgO and a molecular weight of 287.43 g/mol. IUPAC name: magnesium;phenylmethoxybenzene;bromide. InChIKey: VMPINCGEFWWFMA-UHFFFAOYSA-M.
| Molecular formula | C13H11BrMgO |
|---|---|
| Molecular weight | 287.43 g/mol |
| IUPAC name | magnesium;phenylmethoxybenzene;bromide |
| InChIKey | VMPINCGEFWWFMA-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)COC2=CC=[C-]C=C2.[Mg+2].[Br-] |
Computed by PubChem (NCBI)