CAS 36281-96-6 is the registry number for 3–Benzyloxyphenylmagnesium bromide solution. Offered by: GLPBio. Available pack sizes: 100ml.
Magnesium;phenylmethoxybenzene;bromide (CAS 36281-96-6) is a chemical compound with the molecular formula C13H11BrMgO and a molecular weight of 287.43 g/mol. IUPAC name: magnesium;phenylmethoxybenzene;bromide. InChIKey: FWYMDMSRNJRWBW-UHFFFAOYSA-M.
| Molecular formula | C13H11BrMgO |
|---|---|
| Molecular weight | 287.43 g/mol |
| IUPAC name | magnesium;phenylmethoxybenzene;bromide |
| InChIKey | FWYMDMSRNJRWBW-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)COC2=CC=C[C-]=C2.[Mg+2].[Br-] |
Computed by PubChem (NCBI)