CAS 1201924-59-5 is the registry number for 2-Bromopyrido[3,2-d]pyrimidin-6(5H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5H-pyrido[3,2-d]pyrimidin-6-one (CAS 1201924-59-5) is a chemical compound with the molecular formula C7H4BrN3O and a molecular weight of 226.03 g/mol. IUPAC name: 2-bromo-5H-pyrido[3,2-d]pyrimidin-6-one. InChIKey: LCXVYZJPRGTCIX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3O |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-bromo-5H-pyrido[3,2-d]pyrimidin-6-one |
| InChIKey | LCXVYZJPRGTCIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=CN=C(N=C21)Br |
Computed by PubChem (NCBI)