CAS 120200-07-9 is the registry number for H-D-Ala(CF3)-OH, 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2R)-2-amino-4,4,4-trifluorobutanoic acid (CAS 120200-07-9) is a chemical compound with the molecular formula C4H6F3NO2 and a molecular weight of 157.09 g/mol. IUPAC name: (2R)-2-amino-4,4,4-trifluorobutanoic acid. InChIKey: AQPCXCOPDSEKQT-UWTATZPHSA-N.
| Molecular formula | C4H6F3NO2 |
|---|---|
| Molecular weight | 157.09 g/mol |
| IUPAC name | (2R)-2-amino-4,4,4-trifluorobutanoic acid |
| InChIKey | AQPCXCOPDSEKQT-UWTATZPHSA-N |
| SMILES | C([C@H](C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)