CAS 1202029-46-6 is the registry number for Methyl 2-(2,4-difluorophenyl)-5-(4-fluorophenyl)pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
Methyl 1-(2,4-difluorophenyl)-3-(4-fluorophenyl)pyrazole-5-carboxylate (CAS 1202029-46-6) is a chemical compound with the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. IUPAC name: methyl 1-(2,4-difluorophenyl)-3-(4-fluorophenyl)pyrazole-5-carboxylate. InChIKey: IKGJNDNLRZXVEV-UHFFFAOYSA-N.
| Molecular formula | C17H11F3N2O2 |
|---|---|
| Molecular weight | 332.28 g/mol |
| IUPAC name | methyl 1-(2,4-difluorophenyl)-3-(4-fluorophenyl)pyrazole-5-carboxylate |
| InChIKey | IKGJNDNLRZXVEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NN1C2=C(C=C(C=C2)F)F)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)