CAS 1624262-32-3 is the registry number for 2-Hydroxy-n-(3-(trifluoromethyl)phenyl)quinoline-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-quinoline-5-carboxamide (CAS 1624262-32-3) is a chemical compound with the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. IUPAC name: 2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-quinoline-5-carboxamide. InChIKey: JQLNDNLAOFHEQQ-UHFFFAOYSA-N.
| Molecular formula | C17H11F3N2O2 |
|---|---|
| Molecular weight | 332.28 g/mol |
| IUPAC name | 2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-quinoline-5-carboxamide |
| InChIKey | JQLNDNLAOFHEQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=C3C=CC(=O)NC3=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)