CAS 1202029-61-5 is the registry number for 1-(4-Bromophenyl)-5-methyl-1H-pyrazole-4-carbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromophenyl)-5-methylpyrazole-4-carbaldehyde (CAS 1202029-61-5) is a chemical compound with the molecular formula C11H9BrN2O and a molecular weight of 265.11 g/mol. IUPAC name: 1-(4-bromophenyl)-5-methylpyrazole-4-carbaldehyde. InChIKey: QGLJXVCTGBJIFQ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-methylpyrazole-4-carbaldehyde |
| InChIKey | QGLJXVCTGBJIFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Br)C=O |
Computed by PubChem (NCBI)