CAS 1202063-27-1 appears in our catalog under these names: D-Alanine-2,3,3,3-d4, 98 atom % D, min 98% Chemical Purity, D–Alanine–d4, D-Alanine-d4, 99.97%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 10 mg, 5 mg, 10mM/1mL.
(2R)-2-amino-2,3,3,3-tetradeuteriopropanoic acid (CAS 1202063-27-1) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 93.12 g/mol. IUPAC name: (2R)-2-amino-2,3,3,3-tetradeuteriopropanoic acid. InChIKey: QNAYBMKLOCPYGJ-GZZUTIEJSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 93.12 g/mol |
| IUPAC name | (2R)-2-amino-2,3,3,3-tetradeuteriopropanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-GZZUTIEJSA-N |
| SMILES | [2H][C@](C(=O)O)(C([2H])([2H])[2H])N |
Computed by PubChem (NCBI)