Products 1202411-38-8

CAS 1202411-38-8 is the registry number for Rel-methyl (1s,4s)-4-amino-1-methylcyclohexane-1-carboxylate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 4-amino-1-methylcyclohexane-1-carboxylate;hydrochloride (CAS 1202411-38-8) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl 4-amino-1-methylcyclohexane-1-carboxylate;hydrochloride. InChIKey: FCTFNYQBCMDTBK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC namemethyl 4-amino-1-methylcyclohexane-1-carboxylate;hydrochloride
InChIKeyFCTFNYQBCMDTBK-UHFFFAOYSA-N
SMILESCC1(CCC(CC1)N)C(=O)OC.Cl

Computed by PubChem (NCBI)