CAS 1202577-79-4 appears in our catalog under these names: (1S)-4-Chloro-2,3-dihydro-1H-inden-1-ol, 95%, (1S)-4-Chloro-2,3-dihydro-1H-inden-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1S)-4-chloro-2,3-dihydro-1H-inden-1-ol (CAS 1202577-79-4) is a chemical compound with the molecular formula C9H9ClO and a molecular weight of 168.62 g/mol. IUPAC name: (1S)-4-chloro-2,3-dihydro-1H-inden-1-ol. InChIKey: IDHGYOQGMVANDO-VIFPVBQESA-N.
| Molecular formula | C9H9ClO |
|---|---|
| Molecular weight | 168.62 g/mol |
| IUPAC name | (1S)-4-chloro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | IDHGYOQGMVANDO-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1O)C=CC=C2Cl |
Computed by PubChem (NCBI)