Products 1202647-49-1
CAS 1202647-49-1 is the registry number for 2'-(Pyrrolidin-1-ylsulfonyl)-[1,1'-biphenyl]-4-carbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2-pyrrolidin-1-ylsulfonylphenyl)benzaldehyde (CAS 1202647-49-1) is a chemical compound with the molecular formula C17H17NO3S and a molecular weight of 315.4 g/mol. IUPAC name: 4-(2-pyrrolidin-1-ylsulfonylphenyl)benzaldehyde. InChIKey: BTKUAPYQFWWZIT-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 4-(2-pyrrolidin-1-ylsulfonylphenyl)benzaldehyde |
| InChIKey | BTKUAPYQFWWZIT-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)S(=O)(=O)C2=CC=CC=C2C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)