CAS 855715-10-5 appears in our catalog under these names: 1-(4-Methylphenyl)-6-oxo-2-thien-2-ylpiperidine-3-carboxylic acid, 95%, 6-Oxo-2-(thiophen-2-yl)-1-(p-tolyl)piperidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(4-methylphenyl)-6-oxo-2-thiophen-2-ylpiperidine-3-carboxylic acid (CAS 855715-10-5) is a chemical compound with the molecular formula C17H17NO3S and a molecular weight of 315.4 g/mol. IUPAC name: 1-(4-methylphenyl)-6-oxo-2-thiophen-2-ylpiperidine-3-carboxylic acid. InChIKey: KIQDHOPFZJKODK-UHFFFAOYSA-N.
| Molecular formula | C17H17NO3S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 1-(4-methylphenyl)-6-oxo-2-thiophen-2-ylpiperidine-3-carboxylic acid |
| InChIKey | KIQDHOPFZJKODK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(C(CCC2=O)C(=O)O)C3=CC=CS3 |
Computed by PubChem (NCBI)