CAS 1202677-99-3 is the registry number for 2-(5-Nitrofuran-2-yl)-1h-benzo[d]imidazol-7-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(5-nitrofuran-2-yl)-1H-benzimidazol-4-ol (CAS 1202677-99-3) is a chemical compound with the molecular formula C11H7N3O4 and a molecular weight of 245.19 g/mol. IUPAC name: 2-(5-nitrofuran-2-yl)-1H-benzimidazol-4-ol. InChIKey: HFJUERGXXSMFHV-UHFFFAOYSA-N.
| Molecular formula | C11H7N3O4 |
|---|---|
| Molecular weight | 245.19 g/mol |
| IUPAC name | 2-(5-nitrofuran-2-yl)-1H-benzimidazol-4-ol |
| InChIKey | HFJUERGXXSMFHV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)N=C(N2)C3=CC=C(O3)[N+](=O)[O-] |
Computed by PubChem (NCBI)