Products 97632-67-2

CAS 97632-67-2 is the registry number for 7-Methoxycoumarin-3-carbonyl Azide. Offered by: TRC, Chemat. Available pack sizes: 1g, 100mg, 500mg.

Structural formula: {0} (CAS {1})

7-methoxy-2-oxochromene-3-carbonyl azide (CAS 97632-67-2) is a chemical compound with the molecular formula C11H7N3O4 and a molecular weight of 245.19 g/mol. IUPAC name: 7-methoxy-2-oxochromene-3-carbonyl azide. InChIKey: KIPIRQVNIGOHCO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H7N3O4
Molecular weight245.19 g/mol
IUPAC name7-methoxy-2-oxochromene-3-carbonyl azide
InChIKeyKIPIRQVNIGOHCO-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C=C(C(=O)O2)C(=O)N=[N+]=[N-]

Computed by PubChem (NCBI)